1,3-diazidopropane
1,3-diazidopropane structure
|
Common Name | 1,3-diazidopropane | ||
|---|---|---|---|---|
| CAS Number | 100910-72-3 | Molecular Weight | 126.12000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H6N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,3-Diazidopropane (CAS number: 100910-72-3, molecular formula: C3H6N6, molecular weight: 126.12000), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-diazidopropane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C3H6N6 |
|---|---|
| Molecular Weight | 126.12000 |
| Exact Mass | 126.06500 |
| PSA | 99.50000 |
| LogP | 0.90262 |
| InChIKey | WXZXTRCKSOLGKX-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCCN=[N+]=[N-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:88192-19-2
CAS#:791-28-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propane,1,3-diazido |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 100910-72-3? |
| A: Chinese name of 100910-72-3 is 100910-72-3. |
| Q: What English synonyms does 1,3-diazidopropane have? |
| A: English synonyms of 1,3-diazidopropane: Propane,1,3-diazido. |
| Q: What is the InChIKey of 1,3-diazidopropane? |
| A: InChIKey of 1,3-diazidopropane is WXZXTRCKSOLGKX-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1,3-diazidopropane? |
| A: Polar surface area (PSA) of 1,3-diazidopropane is 99.50000. |
| Q: What are the downstream products of 1,3-diazidopropane? |
| A: Related downstream products(CAS) of 1,3-diazidopropane: 88192-19-2;791-28-6. |
| Q: What is the CAS number of 1,3-diazidopropane? |
| A: CAS number of 1,3-diazidopropane is 100910-72-3. |
| Q: What is the SMILES notation of 1,3-diazidopropane? |
| A: SMILES notation of 1,3-diazidopropane is [N-]=[N+]=NCCCN=[N+]=[N-]. |
| Q: What is the English name of 1,3-diazidopropane? |
| A: The English name of 1,3-diazidopropane is 1,3-diazidopropane. |
| Q: What is the molecular formula of 1,3-diazidopropane? |
| A: Molecular formula of 1,3-diazidopropane is C3H6N6. |
| Q: What is the molecular weight of 1,3-diazidopropane? |
| A: Molecular weight of 1,3-diazidopropane is 126.12000. |