1-(Bromomethyl)-2,5-dichloro-3-nitrobenzene structure
|
Common Name | 1-(Bromomethyl)-2,5-dichloro-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1009349-32-9 | Molecular Weight | 284.922 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 346.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrCl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.0±26.5 °C | |
| Name | 1-(Bromomethyl)-2,5-dichloro-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 346.0±37.0 °C at 760 mmHg |
| Molecular Formula | C7H4BrCl2NO2 |
| Molecular Weight | 284.922 |
| Flash Point | 163.0±26.5 °C |
| Exact Mass | 282.880249 |
| PSA | 45.82000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | XPFMDGKKMHNURO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(CBr)c1Cl |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1-(bromomethyl)-2,5-dichloro-3-nitro- |
| Benzene,1-(bromomethyl)-2,5-dichloro-3-nitro |
| 1-(Bromomethyl)-2,5-dichloro-3-nitrobenzene |