2-Chloro-N,N-dimethyl-7H-purin-6-amine structure
|
Common Name | 2-Chloro-N,N-dimethyl-7H-purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 100960-20-1 | Molecular Weight | 197.625 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 404.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H8ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6±23.7 °C | |
| Name | 2-chloro-N,N-dimethyl-7H-purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 404.8±27.0 °C at 760 mmHg |
| Molecular Formula | C7H8ClN5 |
| Molecular Weight | 197.625 |
| Flash Point | 198.6±23.7 °C |
| Exact Mass | 197.046829 |
| PSA | 57.70000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.721 |
| InChIKey | BJAYANZFEQNNDV-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(Cl)nc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7H-Purin-6-amine, 2-chloro-N,N-dimethyl- |
| 2-Chloro-N,N-dimethyl-7H-purin-6-amine |
| 9H-purin-6-amine, 2-chloro-N,N-dimethyl- |
| 9H-Purin-6-amine,2-chloro-N,N-dimethyl |
| 2-CHLORO-N,N-DIMETHYL-9H-PURIN-6-AMINE |
| 2-Chloro-6-dimethylaminopurine |