3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal structure
|
Common Name | 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal | ||
|---|---|---|---|---|
| CAS Number | 100967-19-9 | Molecular Weight | 267.32100 | |
| Density | 1.195g/cm3 | Boiling Point | 420.9ºC at 760mmHg | |
| Molecular Formula | C14H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.4ºC | |
| Name | 3-[(4-aminophenoxy)methyl]-3-ethyl-2,2-dihydroxypentanal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 420.9ºC at 760mmHg |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32100 |
| Flash Point | 208.4ºC |
| Exact Mass | 267.14700 |
| PSA | 92.78000 |
| LogP | 1.91500 |
| Vapour Pressure | 7.76E-08mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | LWDBPNKSEBPGMU-UHFFFAOYSA-N |
| SMILES | CCC(CC)(COc1ccc(N)cc1)C(O)(O)C=O |
|
~%
3-[(4-aminophen... CAS#:100967-19-9 |
| Literature: Ashley et al. Journal of the Chemical Society, 1959 , p. 897,901 |
|
~%
3-[(4-aminophen... CAS#:100967-19-9 |
| Literature: Ashley et al. Journal of the Chemical Society, 1959 , p. 897,901 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-(4,4-Diaethoxy-butoxy)-anilin |
| 4-(p-Aminophenoxy)butyraldehyde diethyl acetal |
| 4-(4-Amino-phenoxy)-butyraldehyd-diaethylacetal |
| M B 3933 |
| 4-(4-amino-phenoxy)-butyraldehyde diethylacetal |
| B 3933 |
| Butyraldehyde,4-(p-aminophenoxy)-,diethyl acetal |