ethyl 4-bromobenzenesulfonyl formimidate
ethyl 4-bromobenzenesulfonyl formimidate structure
|
Common Name | ethyl 4-bromobenzenesulfonyl formimidate | ||
|---|---|---|---|---|
| CAS Number | 100981-68-8 | Molecular Weight | 292.15000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10BrNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 4-bromobenzenesulfonyl formimidate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10BrNO3S |
|---|---|
| Molecular Weight | 292.15000 |
| Exact Mass | 290.95600 |
| PSA | 64.11000 |
| LogP | 3.28340 |
| InChIKey | ZWIQWKIKBWWGKZ-UHFFFAOYSA-N |
| SMILES | CCOC=NS(=O)(=O)c1ccc(Br)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:100981-43-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Aethoxymethylen-4-brom-benzolsulfonamid |
| ethyl N-p-bromobenzene-sulphonylformimidate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of ethyl 4-bromobenzenesulfonyl formimidate? |
| A: LogP of ethyl 4-bromobenzenesulfonyl formimidate is 3.28340. |
| Q: What is the Chinese name of 100981-68-8? |
| A: Chinese name of 100981-68-8 is 100981-68-8. |
| Q: What are the downstream products of ethyl 4-bromobenzenesulfonyl formimidate? |
| A: Related downstream products(CAS) of ethyl 4-bromobenzenesulfonyl formimidate: 100981-43-9. |
| Q: What is the English name of ethyl 4-bromobenzenesulfonyl formimidate? |
| A: The English name of ethyl 4-bromobenzenesulfonyl formimidate is ethyl 4-bromobenzenesulfonyl formimidate. |
| Q: What English synonyms does ethyl 4-bromobenzenesulfonyl formimidate have? |
| A: English synonyms of ethyl 4-bromobenzenesulfonyl formimidate: N-Aethoxymethylen-4-brom-benzolsulfonamid, ethyl N-p-bromobenzene-sulphonylformimidate. |
| Q: What is the molecular formula of ethyl 4-bromobenzenesulfonyl formimidate? |
| A: Molecular formula of ethyl 4-bromobenzenesulfonyl formimidate is C9H10BrNO3S. |
| Q: What is the molecular weight of ethyl 4-bromobenzenesulfonyl formimidate? |
| A: Molecular weight of ethyl 4-bromobenzenesulfonyl formimidate is 292.15000. |
| Q: What is the CAS number of ethyl 4-bromobenzenesulfonyl formimidate? |
| A: CAS number of ethyl 4-bromobenzenesulfonyl formimidate is 100981-68-8. |
| Q: What is the polar surface area (PSA) of ethyl 4-bromobenzenesulfonyl formimidate? |
| A: Polar surface area (PSA) of ethyl 4-bromobenzenesulfonyl formimidate is 64.11000. |
| Q: What is the SMILES notation of ethyl 4-bromobenzenesulfonyl formimidate? |
| A: SMILES notation of ethyl 4-bromobenzenesulfonyl formimidate is CCOC=NS(=O)(=O)c1ccc(Br)cc1. |