2-[bis(2-ethylhexyl)amino]ethanol structure
|
Common Name | 2-[bis(2-ethylhexyl)amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 101-07-5 | Molecular Weight | 285.50800 | |
| Density | 0.862g/cm3 | Boiling Point | 373.6ºC at 760mmHg | |
| Molecular Formula | C18H39NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.9ºC | |
| Name | 2-[bis(2-ethylhexyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.862g/cm3 |
|---|---|
| Boiling Point | 373.6ºC at 760mmHg |
| Molecular Formula | C18H39NO |
| Molecular Weight | 285.50800 |
| Flash Point | 139.9ºC |
| Exact Mass | 285.30300 |
| PSA | 23.47000 |
| LogP | 4.71350 |
| Vapour Pressure | 4.17E-07mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | FMFWSIARXFCACS-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN(CCO)CC(CC)CCCC |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethanol,2-[bis(2-ethylhexyl)amino] |
| 2-Di-(2-ethylhexyl)aminoethanol |
| 2-<Bis-(2-ethyl-hexyl)-amino>-ethanol |
| 2-<Bis-(2-ethyl-hexyl)-amino>-ethan-1-ol |
| EINECS 202-912-6 |