Phenol,4-(phenylmethyl)-, 1-carbamate
Modify Date: 2025-08-25 17:18:44
Phenol,4-(phenylmethyl)-, 1-carbamate structure
|
Common Name | Phenol,4-(phenylmethyl)-, 1-carbamate | ||
|---|---|---|---|---|
| CAS Number | 101-71-3 | Molecular Weight | 227.25900 | |
| Density | 1.173g/cm3 | Boiling Point | 402.6ºC at 760mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.8ºC | |
| Name | (4-benzylphenyl) carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 402.6ºC at 760mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 197.8ºC |
| Exact Mass | 227.09500 |
| PSA | 52.32000 |
| LogP | 3.43520 |
| Vapour Pressure | 1.09E-06mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | ZBJBRUSGEJORQL-UHFFFAOYSA-N |
| SMILES | NC(=O)Oc1ccc(Cc2ccccc2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2924299090 |
|---|
|
~%
Phenol,4-(pheny... CAS#:101-71-3 |
| Literature: Bayer and Co. Patent: DE296889 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 780 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: qHTS assay to identify small molecule antagonists of the androgen receptor (AR) signa...
Source: 824
Target: AR protein [Homo sapiens]
External Id: MDAN535
|
|
Name: qHTS for Inhibitors of human tyrosyl-DNA phosphodiesterase 1 (TDP1): qHTS in cells in...
Source: NCGC
Target: TDP1 protein [Homo sapiens]
External Id: TDP1100
|
|
Name: qHTS for Inhibitors of human tyrosyl-DNA phosphodiesterase 1 (TDP1): qHTS in cells in...
Source: NCGC
Target: TDP1 protein [Homo sapiens]
External Id: TDP1101
|
|
Name: qHTS assay to identify small molecule antagonists of the androgen receptor (AR) sign...
Source: 824
Target: N/A
External Id: MDAV150
|
|
Name: qHTS assay for small molecules that induce genotoxicity in human embryonic kidney cel...
Source: 824
Target: RecName: Full=ATPase family AAA domain-containing protein 5; AltName: Full=Chromosome fragility-associated gene 1 protein
External Id: ELG271
|
|
Name: qHTS assay to identify small molecule antagonists of the thyroid receptor (TR) signal...
Source: 824
Target: thyroid hormone receptor beta isoform 2 [Rattus norvegicus]
External Id: TRN186
|
|
Name: qHTS assay to identify small molecule antagonists of the thyroid receptor (TR) signal...
Source: 824
Target: N/A
External Id: TRV455
|
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
|
Name: Cytotoxic Profiling of Annotated Libraries Using Quantitative High-Throughput Screeni...
Source: NCGC
Target: N/A
External Id: CPF001
|
Total 72, Current Page 1 of 8
1
2
3
4
5
| Oxybulan |
| 4-Carbamoyloxy-1-benzyl-benzol |
| Carbaurine |
| Butolan |
| Parabencil |
| p-Benzylphenyl carbamate |
| Diphenane |
| Palafuge |
| Diphenan |
| Butolen |
| Carphenol |