4,5-Bis(4-methoxyphenyl)-2-(1H-pyrrol-2-yl)-1,3-thiazole structure
|
Common Name | 4,5-Bis(4-methoxyphenyl)-2-(1H-pyrrol-2-yl)-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 101001-71-2 | Molecular Weight | 362.44500 | |
| Density | 1.231g/cm3 | Boiling Point | 558.5ºC at 760mmHg | |
| Molecular Formula | C21H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.5ºC | |
| Name | 4,5-Bis(4-methoxyphenyl)-2-(1H-pyrrol-2-yl)-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 558.5ºC at 760mmHg |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.44500 |
| Flash Point | 291.5ºC |
| Exact Mass | 362.10900 |
| PSA | 75.38000 |
| LogP | 5.48940 |
| Vapour Pressure | 6.22E-12mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | DYASQUCCIHXBLN-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(-c3ccc[nH]3)sc2-c2ccc(OC)cc2)cc1 |
|
~%
4,5-Bis(4-metho... CAS#:101001-71-2 |
| Literature: Seko; Yoshino; Yokota; Tsukamoto Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 3 p. 651 - 657 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,5-Bis(4-methoxyphenyl)-2-(pyrrol-2-yl)-thiazole |
| Thiazole,4,5-bis(4-methoxyphenyl)-2-(1H-pyrrol-2-yl) |
| 4,5-Bis(4-methoxyphenyl)-2-(1H-pyrrol-2-yl)thiazole |