calcium bromate
calcium bromate structure
|
Common Name | calcium bromate | ||
|---|---|---|---|---|
| CAS Number | 10102-75-7 | Molecular Weight | 295.88200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | Br2CaO6 | Melting Point | 180°C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | calcium,dibromate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 180°C |
|---|---|
| Molecular Formula | Br2CaO6 |
| Molecular Weight | 295.88200 |
| Exact Mass | 293.76900 |
| PSA | 114.40000 |
| LogP | 0.97840 |
| InChIKey | GROPHIUSZODNGU-UHFFFAOYSA-L |
| SMILES | [Ca+2].[O-][Br+2]([O-])[O-].[O-][Br+2]([O-])[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| RIDADR | UN1450 |
|---|---|
| Packaging Group | II |
| Hazard Class | 5.1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Bromic acid,calcium salt |
| Calcium bromate |
| calcium dibromate |
| UNII-QJ2S78C3RO |
| EINECS 233-278-9 |
| MFCD00015970 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of calcium,dibromate? |
| A: The English name of calcium,dibromate is calcium,dibromate. |
| Q: What is the CAS number of calcium,dibromate? |
| A: CAS number of calcium,dibromate is 10102-75-7. |
| Q: What English synonyms does calcium,dibromate have? |
| A: English synonyms of calcium,dibromate: Bromic acid,calcium salt, Calcium bromate, calcium dibromate, UNII-QJ2S78C3RO, EINECS 233-278-9, MFCD00015970. |
| Q: What is the molecular formula of calcium,dibromate? |
| A: Molecular formula of calcium,dibromate is Br2CaO6. |
| Q: What is the InChIKey of calcium,dibromate? |
| A: InChIKey of calcium,dibromate is GROPHIUSZODNGU-UHFFFAOYSA-L. |
| Q: What is the molecular weight of calcium,dibromate? |
| A: Molecular weight of calcium,dibromate is 295.88200. |
| Q: What is the polar surface area (PSA) of calcium,dibromate? |
| A: Polar surface area (PSA) of calcium,dibromate is 114.40000. |
| Q: What is the SMILES notation of calcium,dibromate? |
| A: SMILES notation of calcium,dibromate is [Ca+2].[O-][Br+2]([O-])[O-].[O-][Br+2]([O-])[O-]. |
| Q: What is the melting point of calcium,dibromate? |
| A: Melting point of calcium,dibromate is 180°C. |
| Q: What is the LogP of calcium,dibromate? |
| A: LogP of calcium,dibromate is 0.97840. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |