4-Bromopinselin
Modify Date: 2025-09-09 19:06:03
4-Bromopinselin structure
|
Common Name | 4-Bromopinselin | ||
|---|---|---|---|---|
| CAS Number | 101023-72-7 | Molecular Weight | 379.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11BrO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Bromopinselin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H11BrO6 |
|---|---|
| Molecular Weight | 379.16 |
| InChIKey | HOJNNGKFUVBUTP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(O)cc(Br)c2oc3cc(C)cc(O)c3c(=O)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Bromopinselin? |
| A: The English name of 4-Bromopinselin is 4-Bromopinselin. |
| Q: What is the CAS number of 4-Bromopinselin? |
| A: CAS number of 4-Bromopinselin is 101023-72-7. |
| Q: What is the InChIKey of 4-Bromopinselin? |
| A: InChIKey of 4-Bromopinselin is HOJNNGKFUVBUTP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-Bromopinselin? |
| A: SMILES notation of 4-Bromopinselin is COC(=O)c1c(O)cc(Br)c2oc3cc(C)cc(O)c3c(=O)c12. |
| Q: What is the molecular weight of 4-Bromopinselin? |
| A: Molecular weight of 4-Bromopinselin is 379.16. |
| Q: What is the molecular formula of 4-Bromopinselin? |
| A: Molecular formula of 4-Bromopinselin is C16H11BrO6. |
| Q: What is the Chinese name of 101023-72-7? |
| A: Chinese name of 101023-72-7 is 101023-72-7. |