triethylamine oleate structure
|
Common Name | triethylamine oleate | ||
|---|---|---|---|---|
| CAS Number | 10103-17-0 | Molecular Weight | 383.65100 | |
| Density | N/A | Boiling Point | 360ºC at 760mmHg | |
| Molecular Formula | C24H49NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.1ºC | |
| Name | triethylamine oleate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 360ºC at 760mmHg |
|---|---|
| Molecular Formula | C24H49NO2 |
| Molecular Weight | 383.65100 |
| Flash Point | 270.1ºC |
| Exact Mass | 383.37600 |
| PSA | 40.54000 |
| LogP | 7.45660 |
| Vapour Pressure | 3.7E-06mmHg at 25°C |
| InChIKey | GCVIWLTVOFILLW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.CCN(CC)CC |
| HS Code | 2921199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| oleic acid,compound with triethylamine |
| 9-octadecenoicacid(z)-,compd.withn,n-diethylethanamine(1:1) |