1-(4-chlorophenyl)pyrimidine-2,4-dione
1-(4-chlorophenyl)pyrimidine-2,4-dione structure
|
Common Name | 1-(4-chlorophenyl)pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 101080-71-1 | Molecular Weight | 222.62800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-(4-Chlorophenyl)pyrimidine-2,4-dione (CAS number: 101080-71-1, molecular formula: C10H7ClN2O2, molecular weight: 222.63), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-chlorophenyl)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7ClN2O2 |
|---|---|
| Molecular Weight | 222.62800 |
| Exact Mass | 222.02000 |
| PSA | 55.12000 |
| LogP | 1.59150 |
| InChIKey | GLUGEITYGBVXPJ-UHFFFAOYSA-N |
| SMILES | O=c1ccn(-c2ccc(Cl)cc2)c(=O)[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~56%
1-(4-chlorophen... CAS#:101080-71-1 |
| Literature: Soltanirad, Mohammad Navid; Behrouz, Somayeh; Doroodmand, Mohammad Mahdi; Moghtaderi, Noushin Synthesis, 2011 , # 23 art. no. Z74311SS, p. 3915 - 3924 |
|
~%
1-(4-chlorophen... CAS#:101080-71-1 |
| Literature: Winckelmann, Ib; Larsen, Erik H. Synthesis, 1986 , # 12 p. 1041 - 1044 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(4-Chlor-phenyl)-1H-pyrimidin-2,4-dion |
| 1-(4-chlorophenyl)pyrimidine-2,4(1H,3H)-dione |
| 2,4(1H,3H)-Pyrimidinedione,1-(4-chlorophenyl) |
| 1-(4-chloro-phenyl)-1H-pyrimidine-2,4-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(4-chlorophenyl)pyrimidine-2,4-dione? |
| A: SMILES notation of 1-(4-chlorophenyl)pyrimidine-2,4-dione is O=c1ccn(-c2ccc(Cl)cc2)c(=O)[nH]1. |
| Q: What are the upstream materials of 1-(4-chlorophenyl)pyrimidine-2,4-dione? |
| A: Related upstream materials(CAS) of 1-(4-chlorophenyl)pyrimidine-2,4-dione: 637-87-6;66-22-8;7424-91-1;140-38-5. |
| Q: What is the Chinese name of 101080-71-1? |
| A: Chinese name of 101080-71-1 is 101080-71-1. |
| Q: What is the CAS number of 1-(4-chlorophenyl)pyrimidine-2,4-dione? |
| A: CAS number of 1-(4-chlorophenyl)pyrimidine-2,4-dione is 101080-71-1. |
| Q: What is the molecular weight of 1-(4-chlorophenyl)pyrimidine-2,4-dione? |
| A: Molecular weight of 1-(4-chlorophenyl)pyrimidine-2,4-dione is 222.62800. |
| Q: What English synonyms does 1-(4-chlorophenyl)pyrimidine-2,4-dione have? |
| A: English synonyms of 1-(4-chlorophenyl)pyrimidine-2,4-dione: 1-(4-Chlor-phenyl)-1H-pyrimidin-2,4-dion, 1-(4-chlorophenyl)pyrimidine-2,4(1H,3H)-dione, 2,4(1H,3H)-Pyrimidinedione,1-(4-chlorophenyl), 1-(4-chloro-phenyl)-1H-pyrimidine-2,4-dione. |
| Q: What is the LogP of 1-(4-chlorophenyl)pyrimidine-2,4-dione? |
| A: LogP of 1-(4-chlorophenyl)pyrimidine-2,4-dione is 1.59150. |
| Q: What is the molecular formula of 1-(4-chlorophenyl)pyrimidine-2,4-dione? |
| A: Molecular formula of 1-(4-chlorophenyl)pyrimidine-2,4-dione is C10H7ClN2O2. |
| Q: What is the polar surface area (PSA) of 1-(4-chlorophenyl)pyrimidine-2,4-dione? |
| A: Polar surface area (PSA) of 1-(4-chlorophenyl)pyrimidine-2,4-dione is 55.12000. |
| Q: What is the InChIKey of 1-(4-chlorophenyl)pyrimidine-2,4-dione? |
| A: InChIKey of 1-(4-chlorophenyl)pyrimidine-2,4-dione is GLUGEITYGBVXPJ-UHFFFAOYSA-N. |