(E)-3-(4-bromophenyl)-2-cyanoacrylamide structure
|
Common Name | (E)-3-(4-bromophenyl)-2-cyanoacrylamide | ||
|---|---|---|---|---|
| CAS Number | 101085-21-6 | Molecular Weight | 251.07900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-bromophenyl)-2-cyanoprop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7BrN2O |
|---|---|
| Molecular Weight | 251.07900 |
| Exact Mass | 249.97400 |
| PSA | 67.87000 |
| LogP | 2.99108 |
| InChIKey | JTTTWTYPKBLSRW-VMPITWQZSA-N |
| SMILES | N#CC(=Cc1ccc(Br)cc1)C(N)=O |
|
~76%
(E)-3-(4-bromop... CAS#:101085-21-6 |
| Literature: Reddy, T. Indrasena; Varma, Rajender S. Tetrahedron Letters, 1997 , vol. 38, # 10 p. 1721 - 1724 |
|
~%
(E)-3-(4-bromop... CAS#:101085-21-6 |
| Literature: Li, Ping; Teng, Bo-Tao; Jin, Fa-Gen; Li, Xin-Sheng; Zhu, Wei-Dong; Xie, Jian-Wu Organic and Biomolecular Chemistry, 2012 , vol. 10, # 2 p. 244 - 247 |
|
~%
(E)-3-(4-bromop... CAS#:101085-21-6 |
| Literature: Li, Ping; Teng, Bo-Tao; Jin, Fa-Gen; Li, Xin-Sheng; Zhu, Wei-Dong; Xie, Jian-Wu Organic and Biomolecular Chemistry, 2012 , vol. 10, # 2 p. 244 - 247 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(4-Brom-phenyl)-2-cyan-acrylamid |
| 2-Propenamide,3-(4-bromophenyl)-2-cyano |
| (E)-3-(4-bromophenyl)-2-cyano-2-propenamide |
| 3-(4-bromophenyl)-2-cyanoacrylamide |