4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide
Modify Date: 2026-07-16 19:40:03
4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide structure
|
Common Name | 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1010912-34-1 | Molecular Weight | 357.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H27N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H27N3OS |
|---|---|
| Molecular Weight | 357.5 |
| InChIKey | CIVYPHMVYFMNHI-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NC1CC(C)(C)NC(C)(C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide? |
| A: Molecular weight of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide is 357.5. |
| Q: What is the English name of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide? |
| A: The English name of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide is 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide. |
| Q: What is the InChIKey of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide? |
| A: InChIKey of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide is CIVYPHMVYFMNHI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide? |
| A: CAS number of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide is 1010912-34-1. |
| Q: What is the SMILES notation of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide? |
| A: SMILES notation of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide is Cc1nc(-c2ccccc2)sc1C(=O)NC1CC(C)(C)NC(C)(C)C1. |
| Q: What is the Chinese name of 1010912-34-1? |
| A: Chinese name of 1010912-34-1 is 1010912-34-1. |
| Q: What is the molecular formula of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide? |
| A: Molecular formula of 4-methyl-2-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-thiazole-5-carboxamide is C20H27N3OS. |