1,2,4,7-Phenanthrenetetrol,1,2,4,7-tetraacetate structure
|
Common Name | 1,2,4,7-Phenanthrenetetrol,1,2,4,7-tetraacetate | ||
|---|---|---|---|---|
| CAS Number | 10117-19-8 | Molecular Weight | 410.37400 | |
| Density | 1.331g/cm3 | Boiling Point | 589.3ºC at 760mmHg | |
| Molecular Formula | C22H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257ºC | |
| Name | (5,7,8-triacetyloxyphenanthren-2-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 589.3ºC at 760mmHg |
| Molecular Formula | C22H18O8 |
| Molecular Weight | 410.37400 |
| Flash Point | 257ºC |
| Exact Mass | 410.10000 |
| PSA | 105.20000 |
| LogP | 3.69420 |
| Vapour Pressure | 7.25E-14mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | CMSJCDYFMYXGSR-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc2c(ccc3c(OC(C)=O)c(OC(C)=O)cc(OC(C)=O)c32)c1 |
|
~%
1,2,4,7-Phenant... CAS#:10117-19-8 |
| Literature: Newman,M.S.; Childers,R.L. Journal of Organic Chemistry, 1967 , vol. 32, p. 62 - 66 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2,4,7-Tetraacetoxy-phenanthren |