1-(4-Methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone structure
|
Common Name | 1-(4-Methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 1011711-59-3 | Molecular Weight | 190.199 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-Methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.199 |
| Exact Mass | 190.074234 |
| PSA | 54.98000 |
| LogP | 1.99 |
| Index of Refraction | 1.626 |
| InChIKey | QNIZRNPMEIPUHB-UHFFFAOYSA-N |
| SMILES | COc1ccnc2[nH]cc(C(C)=O)c12 |
|
~56%
1-(4-Methoxy-1H... CAS#:1011711-59-3 |
| Literature: Echalier, Aude; Bettayeb, Karima; Ferandin, Yoan; Lozach, Olivier; Clement, Monique; Valette, Annie; Liger, Francois; Marquet, Bernard; Morris, Jonathan C.; Endicott, Jane A.; Joseph, Benoit; Meijer, Laurent Journal of Medicinal Chemistry, 2008 , vol. 51, # 4 p. 737 - 751 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-acetyl-4-methoxy-1H-indole |
| Ethanone, 1-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)- |
| 1-(4-Methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone |
| 3-Acetyl-4-methoxyindole |
| 3-Acetyl-4-methoxy-7-azaindole |