(2S)-2-Amino-3-(3,4-dimethoxyphenyl)-2-methyl-propanoic acid structure
|
Common Name | (2S)-2-Amino-3-(3,4-dimethoxyphenyl)-2-methyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 10128-06-0 | Molecular Weight | 239.26800 | |
| Density | 1.186 g/cm3 | Boiling Point | 379.6ºC at 760 mmHg | |
| Molecular Formula | C12H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186 g/cm3 |
|---|---|
| Boiling Point | 379.6ºC at 760 mmHg |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.26800 |
| Exact Mass | 239.11600 |
| PSA | 81.78000 |
| LogP | 1.74860 |
| InChIKey | QCCQWLWXLUTSAK-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(C)(N)C(=O)O)cc1OC |
| HS Code | 2922509090 |
|---|
|
~%
(2S)-2-Amino-3-... CAS#:10128-06-0 |
| Literature: Tetrahedron, , vol. 44, # 17 p. 5343 - 5354 |
|
~%
(2S)-2-Amino-3-... CAS#:10128-06-0 |
| Literature: Tetrahedron, , vol. 44, # 17 p. 5343 - 5354 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2s)-2-amino-3-(3,4-dimethoxyphenyl)-2-methyl-propanoic acid |
| 3-(3,4-Dimethoxyphenyl)-2-methylalanin |
| L-Dopa antagonist |
| 2-Amino-3-(3,4-dimethoxy-phenyl)-2-methyl-propionsaeure |
| 2-amino-3-(3,4-dimethoxy-phenyl)-2-methyl-propionic acid |
| MFCD00050387 |