2H-Furo[3,4-b]pyran-4,7(3H,5H)-dione,2,2,5-trimethyl- structure
|
Common Name | 2H-Furo[3,4-b]pyran-4,7(3H,5H)-dione,2,2,5-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 1013-11-2 | Molecular Weight | 196.20000 | |
| Density | 1.24g/cm3 | Boiling Point | 327ºC at 760mmHg | |
| Molecular Formula | C10H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.6ºC | |
| Name | 2,2,5-trimethyl-3,5-dihydrofuro[3,4-b]pyran-4,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 327ºC at 760mmHg |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20000 |
| Flash Point | 145.6ºC |
| Exact Mass | 196.07400 |
| PSA | 52.60000 |
| LogP | 0.95380 |
| Vapour Pressure | 0.000208mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | LTAPDSGQJXHWON-UHFFFAOYSA-N |
| SMILES | CC1OC(=O)C2=C1C(=O)CC(C)(C)O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2,5-Trimethyl-2,3-dihydro-5H-furo[3,4-b]pyran-4,7-dion |
| 2,2,5-trimethyl-2,3-dihydro-5H-furo[3,4-b]pyran-4,7-dione |
| trimethylisopatulin |
| 2,2,5-Trimethyl-2H-furo[3,4-b]pyran-4,7(3H,5H)-dione |