trimethyl-(2,4,6-trichlorophenoxy)silane structure
|
Common Name | trimethyl-(2,4,6-trichlorophenoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 1013-45-2 | Molecular Weight | 269.62800 | |
| Density | 1.236g/cm3 | Boiling Point | 269.9ºC at 760 mmHg | |
| Molecular Formula | C9H11Cl3OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2,4,6-trichlorophenoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 269.9ºC at 760 mmHg |
| Molecular Formula | C9H11Cl3OSi |
| Molecular Weight | 269.62800 |
| Exact Mass | 267.96400 |
| PSA | 9.23000 |
| LogP | 4.86050 |
| Vapour Pressure | 0.0117mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | RIYJZVOGDQXZPS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Oc1c(Cl)cc(Cl)cc1Cl |
| HS Code | 2931900090 |
|---|
|
~%
trimethyl-(2,4,... CAS#:1013-45-2 |
| Literature: Cooper,G.D. Journal of Organic Chemistry, 1961 , vol. 26, p. 925 - 929 |
|
~82%
trimethyl-(2,4,... CAS#:1013-45-2 |
| Literature: Blaschette, Armand; Wieland, Elke; Hamann, Thomas; Harris, Robin K. Zeitschrift fuer Naturforschung, B: Chemical Sciences, 1992 , vol. 47, # 12 p. 1693 - 1700 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1-Trimethylsilyloxy-2,4,6-trichlorbenzol |
| 2,4,6-Trichlorphenoxy-trimethyl-silan |
| Phenol,2,4,6-trichloro,TMS |
| Me3Si(OC6H2Cl3-2,4,6) |
| 2,4,6-Trichlor-trimethylsilylphenol |
| 2,4,6-trichlorophenol-TMS |