2-chloro-1-benzothiophene 1,1-dioxide
2-chloro-1-benzothiophene 1,1-dioxide structure
|
Common Name | 2-chloro-1-benzothiophene 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 10133-41-2 | Molecular Weight | 200.64200 | |
| Density | 1.56g/cm3 | Boiling Point | 400.6ºC at 760mmHg | |
| Molecular Formula | C8H5ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-1-benzothiophene 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 400.6ºC at 760mmHg |
| Molecular Formula | C8H5ClO2S |
| Molecular Weight | 200.64200 |
| Flash Point | 196.1ºC |
| Exact Mass | 199.97000 |
| PSA | 42.52000 |
| LogP | 3.09190 |
| Vapour Pressure | 2.91E-06mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | LCOSOVJANPTUTA-UHFFFAOYSA-N |
| SMILES | O=S1(=O)C(Cl)=Cc2ccccc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
![2,3-dichloro-2,3-dihydro-benzo[b]thiophene-1,1-dioxide Structure](https://image.chemsrc.com/caspic/228/872827-66-2.png)
CAS#:872827-66-2![Benzo[b]thiophene-1,1-dioxide Structure](https://image.chemsrc.com/caspic/042/825-44-5.png)
CAS#:825-44-5
CAS#:110-86-1
CAS#:71-43-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzo[b]thiophene,2-chloro-,1,1-dioxide |
| InChI=1/C8H5ClO2S/c9-8-5-6-3-1-2-4-7(6)12(8,10)11/h1-5 |
| 2-Chlorobenzothiophene sulfone |
| 2-Chlor-benzo[b]thiophen-1,1-dioxid |
| 2-chlorobenzo<b>thiophene S,S-dioxide |
| 2-chloro-benzo[b]thiophene-1,1-dioxide |
| 1,1-dioxo-2-chlorobenzo<b>thiophene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-chloro-1-benzothiophene 1,1-dioxide? |
| A: CAS number of 2-chloro-1-benzothiophene 1,1-dioxide is 10133-41-2. |
| Q: What is the boiling point of 2-chloro-1-benzothiophene 1,1-dioxide? |
| A: Boiling point of 2-chloro-1-benzothiophene 1,1-dioxide is 400.6ºC at 760mmHg. |
| Q: What English synonyms does 2-chloro-1-benzothiophene 1,1-dioxide have? |
| A: English synonyms of 2-chloro-1-benzothiophene 1,1-dioxide: Benzo[b]thiophene,2-chloro-,1,1-dioxide, InChI=1/C8H5ClO2S/c9-8-5-6-3-1-2-4-7(6)12(8,10)11/h1-5, 2-Chlorobenzothiophene sulfone, 2-Chlor-benzo[b]thiophen-1,1-dioxid, 2-chlorobenzothiophene S,S-dioxide, 2-chloro-benzo[b]thiophene-1,1-dioxide, 1,1-dioxo-2-chlorobenzothiophene. |
| Q: What is the SMILES notation of 2-chloro-1-benzothiophene 1,1-dioxide? |
| A: SMILES notation of 2-chloro-1-benzothiophene 1,1-dioxide is O=S1(=O)C(Cl)=Cc2ccccc21. |
| Q: What is the InChIKey of 2-chloro-1-benzothiophene 1,1-dioxide? |
| A: InChIKey of 2-chloro-1-benzothiophene 1,1-dioxide is LCOSOVJANPTUTA-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-chloro-1-benzothiophene 1,1-dioxide? |
| A: Polar surface area (PSA) of 2-chloro-1-benzothiophene 1,1-dioxide is 42.52000. |
| Q: What is the Chinese name of 10133-41-2? |
| A: Chinese name of 10133-41-2 is 10133-41-2. |
| Q: What is the LogP of 2-chloro-1-benzothiophene 1,1-dioxide? |
| A: LogP of 2-chloro-1-benzothiophene 1,1-dioxide is 3.09190. |
| Q: What is the English name of 2-chloro-1-benzothiophene 1,1-dioxide? |
| A: The English name of 2-chloro-1-benzothiophene 1,1-dioxide is 2-chloro-1-benzothiophene 1,1-dioxide. |
| Q: What are the upstream materials of 2-chloro-1-benzothiophene 1,1-dioxide? |
| A: Related upstream materials(CAS) of 2-chloro-1-benzothiophene 1,1-dioxide: 872827-66-2;825-44-5;110-86-1;71-43-2. |