3-(4-FLUORO-PHENYL)-1H-INDOLE structure
|
Common Name | 3-(4-FLUORO-PHENYL)-1H-INDOLE | ||
|---|---|---|---|---|
| CAS Number | 101366-50-1 | Molecular Weight | 297.71400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-nitrophenyl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8ClNO4S |
|---|---|
| Molecular Weight | 297.71400 |
| Exact Mass | 296.98600 |
| PSA | 88.34000 |
| LogP | 4.79330 |
| InChIKey | KTXDVWDRGRWSJW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc(S(=O)(=O)Cl)cc2)c1 |
|
~82%
3-(4-FLUORO-PHE... CAS#:101366-50-1 |
| Literature: Greig, Iain R.; Idris, Aymen I.; Ralston, Stuart H.; Van't Hof, Rob J. Journal of Medicinal Chemistry, 2006 , vol. 49, # 25 p. 7487 - 7492 |
|
~66%
3-(4-FLUORO-PHE... CAS#:101366-50-1 |
| Literature: Ha-Duong; Dijols; Marques-Soares; Minoletti; Dansette; Mansuy Journal of Medicinal Chemistry, 2001 , vol. 44, # 22 p. 3622 - 3631 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3'-nitro-biphenyl-4-sulfonyl chloride |