1-[2-[2-[bis(2,6-diethylphenyl)methoxy]ethoxy]ethyl]-4-methylpiperazine structure
|
Common Name | 1-[2-[2-[bis(2,6-diethylphenyl)methoxy]ethoxy]ethyl]-4-methylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 10140-08-6 | Molecular Weight | 466.69800 | |
| Density | 1.005g/cm3 | Boiling Point | 537.7ºC at 760 mmHg | |
| Molecular Formula | C30H46N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.6ºC | |
| Name | 1-[2-[2-[bis(2,6-diethylphenyl)methoxy]ethoxy]ethyl]-4-methylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.005g/cm3 |
|---|---|
| Boiling Point | 537.7ºC at 760 mmHg |
| Molecular Formula | C30H46N2O2 |
| Molecular Weight | 466.69800 |
| Flash Point | 131.6ºC |
| Exact Mass | 466.35600 |
| PSA | 24.94000 |
| LogP | 5.18200 |
| Vapour Pressure | 1.24E-11mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | LKAFZYPMWORKEH-UHFFFAOYSA-N |
| SMILES | CCc1cccc(CC)c1C(OCCOCCN1CCN(C)CC1)c1c(CC)cccc1CC |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-4-{2-[2-(2,6,2',6'-tetraethyl-benzhydryloxy)-ethoxy]-ethyl}-piperazine |
| Piperazine,1-(2-(2-(bis(2,6-diethylphenyl)methoxy)ethoxy)ethyl)-4-methyl |