2-(ethoxymethyl)-1-hydroxyanthracene-9,10-dione structure
|
Common Name | 2-(ethoxymethyl)-1-hydroxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 101451-69-8 | Molecular Weight | 282.29100 | |
| Density | N/A | Boiling Point | 464.265ºC at 760 mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.335ºC | |
| Name | 2-(ethoxymethyl)-1-hydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 464.265ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 173.335ºC |
| Exact Mass | 282.08900 |
| PSA | 63.60000 |
| LogP | 2.70410 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | QZDBKOGMXKMLQE-UHFFFAOYSA-N |
| SMILES | CCOCc1ccc2c(c1O)C(=O)c1ccccc1C2=O |
|
~%
2-(ethoxymethyl... CAS#:101451-69-8 |
| Literature: Bhavsar et al. Journal of Scientific and Industrial Research, 1957 , vol. 16 B, p. 392,397 |
| 2-ethoxymethyl-1-hydroxy-anthraquinone |
| 9,10-Anthracenedione,2-(ethoxymethyl)-1-hydroxy |
| 2-Aethoxymethyl-1-hydroxy-anthrachinon |