2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile
2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile structure
|
Common Name | 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile | ||
|---|---|---|---|---|
| CAS Number | 1015-44-7 | Molecular Weight | 264.12800 | |
| Density | 1.456g/cm3 | Boiling Point | 447.2ºC at 760mmHg | |
| Molecular Formula | C9H7Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 447.2ºC at 760mmHg |
| Molecular Formula | C9H7Cl2NO2S |
| Molecular Weight | 264.12800 |
| Flash Point | 224.3ºC |
| Exact Mass | 262.95700 |
| PSA | 66.31000 |
| LogP | 3.32548 |
| Vapour Pressure | 3.43E-08mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | AYFIWYZUNSSWKP-UHFFFAOYSA-N |
| SMILES | N#CC(Cl)CS(=O)(=O)c1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~93%
2-chloro-3-(4-c... CAS#:1015-44-7 |
| Literature: Journal of the Chinese Chemical Society, , vol. 54, # 2 p. 447 - 452 |
|
~%
2-chloro-3-(4-c... CAS#:1015-44-7 |
| Literature: Journal of the Chemical Society, , p. 4962 - 4971 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 1 | |
CAS#:64326-48-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-chloro-3-(4-chloro-benzenesulfonyl)-propionitrile |
| 2-Chlor-3-(p-chlorphenylsulfonyl)propionitril |
| Propanenitrile,2-chloro-3-[(4-chlorophenyl)sulfonyl] |
| 2-Chlor-3-(4-chlor-benzolsulfonyl)-propionitril |
| 2-Chlor-3-(4-chlorphenylsulfonyl)-propionitril |
| 2-Chloro-3-((p-chlorophenyl)sulfonyl)propionitrile |
| 3-(4-Chlor-benzolsulfonyl)-2-chlor-propionsaeurenitril |
| 2-chloro-3-[(4-chlorophenyl)sulfonyl]propanenitrile |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile? |
| A: Related upstream materials(CAS) of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile: 14752-66-0;920-37-6;98-60-2;107-13-1. |
| Q: What is the CAS number of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile? |
| A: CAS number of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile is 1015-44-7. |
| Q: What is the Chinese name of 1015-44-7? |
| A: Chinese name of 1015-44-7 is 1015-44-7. |
| Q: What is the LogP of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile? |
| A: LogP of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile is 3.32548. |
| Q: What is the molecular formula of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile? |
| A: Molecular formula of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile is C9H7Cl2NO2S. |
| Q: What is the boiling point of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile? |
| A: Boiling point of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile is 447.2ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile? |
| A: Polar surface area (PSA) of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile is 66.31000. |
| Q: What English synonyms does 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile have? |
| A: English synonyms of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile: 2-chloro-3-(4-chloro-benzenesulfonyl)-propionitrile, 2-Chlor-3-(p-chlorphenylsulfonyl)propionitril, Propanenitrile,2-chloro-3-[(4-chlorophenyl)sulfonyl], 2-Chlor-3-(4-chlor-benzolsulfonyl)-propionitril, 2-Chlor-3-(4-chlorphenylsulfonyl)-propionitril, 2-Chloro-3-((p-chlorophenyl)sulfonyl)propionitrile, 3-(4-Chlor-benzolsulfonyl)-2-chlor-propionsaeurenitril, 2-chloro-3-[(4-chlorophenyl)sulfonyl]propanenitrile. |
| Q: What is the InChIKey of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile? |
| A: InChIKey of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile is AYFIWYZUNSSWKP-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile? |
| A: SMILES notation of 2-chloro-3-(4-chlorophenyl)sulfonylpropanenitrile is N#CC(Cl)CS(=O)(=O)c1ccc(Cl)cc1. |