Propanoic acid,2,2'-oxybis[2-methyl- structure
|
Common Name | Propanoic acid,2,2'-oxybis[2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 10151-15-2 | Molecular Weight | 190.19400 | |
| Density | 1.216g/cm3 | Boiling Point | 381.1ºC at 760mmHg | |
| Molecular Formula | C8H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.1ºC | |
| Name | 2-(2-carboxypropan-2-yloxy)-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 381.1ºC at 760mmHg |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19400 |
| Flash Point | 154.1ºC |
| Exact Mass | 190.08400 |
| PSA | 83.83000 |
| LogP | 0.72940 |
| Vapour Pressure | 7.3E-07mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | RJYYBURLNQJOMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(OC(C)(C)C(=O)O)C(=O)O |
|
~%
Propanoic acid,... CAS#:10151-15-2 |
| Literature: Rodina,L.L.; Korobitsyna,I.K. Journal of Organic Chemistry USSR (English Translation), 1968 , vol. 4, p. 2133 - 2136 Zhurnal Organicheskoi Khimii, 1968 , vol. 4, # 12 p. 2212 - 2216 |
|
~%
Propanoic acid,... CAS#:10151-15-2 |
| Literature: Nasarow; Wercholetowa Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1941 , p. 556,562 Chem.Abstr., 1943 , p. 2343 |
|
~%
Detail
|
| Literature: Korobizyna et al. Zhurnal Obshchei Khimii, 1959 , vol. 29, p. 2190,2194; engl. Ausg. S. 2157, 2160 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| tetramethyl-3-oxa-glutaric acid |
| Tetramethyl-3-oxa-glutarsaeure |
| Tetramethyldiglykolsaeure |
| 2,2'-dimethyl-2,2'-oxy-bis-propionic acid |