Neurokinin B TFA
Modify Date: 2025-08-28 00:39:54
Neurokinin B TFA structure
|
Common Name | Neurokinin B TFA | ||
|---|---|---|---|---|
| CAS Number | 101536-55-4 | Molecular Weight | 1438.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C55H79N13O14S2.2C2HF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Neurokinin B TFANeurokinin B TFA belongs to the tachykinin family of peptides. Neurokinin B binds a family of GPCRs-including neurokinin receptor 1 (NK1R), NK2R, and NK3R-to mediate their biological effect[1]. |
| Name | Neurokinin B TFA |
|---|
| Description | Neurokinin B TFA belongs to the tachykinin family of peptides. Neurokinin B binds a family of GPCRs-including neurokinin receptor 1 (NK1R), NK2R, and NK3R-to mediate their biological effect[1]. |
|---|---|
| Related Catalog | |
| Target |
Neurokinin receptor[1] |
| References |
[1]. Navarro VM. Interactions between kisspeptins and neurokinin B. Adv Exp Med Biol. 2013;784:325-47. |
| Molecular Formula | C55H79N13O14S2.2C2HF3O2 |
|---|---|
| Molecular Weight | 1438.47 |
| InChIKey | DNRDWNMILBSVKQ-LZFAISSQSA-N |
| SMILES | CSCCC(NC(=O)C(CC(C)C)NC(=O)CNC(=O)C(NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)C(CC(=O)O)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(CCSC)NC(=O)C(N)CC(=O)O)C(C)C)C(N)=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| Storage condition | 2-8℃ |