Benzenesulfonic acid,4-nitro-, 1,4-butanediyl ester (9CI) structure
|
Common Name | Benzenesulfonic acid,4-nitro-, 1,4-butanediyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 10154-67-3 | Molecular Weight | 460.43600 | |
| Density | 1.518g/cm3 | Boiling Point | 669.4ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O10S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.6ºC | |
| Name | 4-(4-nitrophenyl)sulfonyloxybutyl 4-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.518g/cm3 |
|---|---|
| Boiling Point | 669.4ºC at 760 mmHg |
| Molecular Formula | C16H16N2O10S2 |
| Molecular Weight | 460.43600 |
| Flash Point | 358.6ºC |
| Exact Mass | 460.02500 |
| PSA | 195.14000 |
| LogP | 5.60200 |
| Vapour Pressure | 4.94E-17mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | IHDDYQPZDSDOCZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)OCCCCOS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
Benzenesulfonic... CAS#:10154-67-3 |
| Literature: Ishidate et al. Pharmaceutical Bulletin, 1957 , vol. 5, p. 203 Chemical and Pharmaceutical Bulletin, 1958 , vol. 6, p. 164,166 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Tetramethylenebis(p-nitrobenzenesulfonate) |
| butane-1,4-diyl bis(4-nitrobenzenesulfonate) |
| 1,4-Bis-(4-nitro-benzolsulfonyloxy)-butan |
| 1,4-bis-(4-nitro-benzenesulfonyloxy)-butane |