6-methyl-2-(propylamino)-1H-quinazolin-4-one structure
|
Common Name | 6-methyl-2-(propylamino)-1H-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 1015479-08-9 | Molecular Weight | 217.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-2-(propylamino)-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15N3O |
|---|---|
| Molecular Weight | 217.26700 |
| Exact Mass | 217.12200 |
| PSA | 61.27000 |
| LogP | 1.88760 |
| InChIKey | CDWADKBTZMKABJ-UHFFFAOYSA-N |
| SMILES | CCCNc1nc2ccc(C)cc2c(=O)[nH]1 |
| HS Code | 2933990090 |
|---|
|
~97%
6-methyl-2-(pro... CAS#:1015479-08-9 |
| Literature: Zeghida, Walid; Debray, Julien; Chierici, Sabine; Dumy, Pascal; Demeunynck, Martine Journal of Organic Chemistry, 2008 , vol. 73, # 6 p. 2473 - 2475 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Methyl-2-propylamino-3H-quinazolin-4-one |
| 6-METHYL-2-PROPYLAMINO-3H-4-QUINAZOLINONE |