meta-METHOXYTOPOLIN RIBOSIDE (MemTR) structure
|
Common Name | meta-METHOXYTOPOLIN RIBOSIDE (MemTR) | ||
|---|---|---|---|---|
| CAS Number | 101565-95-1 | Molecular Weight | 387.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of meta-METHOXYTOPOLIN RIBOSIDE (MemTR)N-[(3-Methoxyphenyl)methyl]adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | N6-(3-methoxybenzyl)adenosine |
|---|---|
| Synonym | More Synonyms |
| Description | N-[(3-Methoxyphenyl)methyl]adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H21N5O5 |
|---|---|
| Molecular Weight | 387.39 |
| Exact Mass | 387.15400 |
| PSA | 134.78000 |
| LogP | 0.13150 |
| InChIKey | YUPMHVHUPBAVAS-SCFUHWHPSA-N |
| SMILES | COc1cccc(CNc2ncnc3c2ncn3C2OC(CO)C(O)C2O)c1 |
| meta-methoxytopolin riboside |