Iso-Olomoucine structure
|
Common Name | Iso-Olomoucine | ||
|---|---|---|---|---|
| CAS Number | 101622-50-8 | Molecular Weight | 298.343 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 579.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C15H18N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.3±32.9 °C | |
| Name | 2-[[6-(benzylamino)-7-methylpurin-2-yl]amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 579.6±60.0 °C at 760 mmHg |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.343 |
| Flash Point | 304.3±32.9 °C |
| Exact Mass | 298.154205 |
| PSA | 87.89000 |
| LogP | -0.08 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | WOQKMUDQRKXVLO-UHFFFAOYSA-N |
| SMILES | Cn1cnc2nc(NCCO)nc(NCc3ccccc3)c21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethanol, 2-[[7-methyl-6-[(phenylmethyl)amino]-7H-purin-2-yl]amino]- |
| 6-Benzylamino-2-(2-hydroxyethylamino)-7-methylpurine |
| Ethanol,2-[[7-methyl-6-[(phenylmethyl)amino]-7H-purin-2-yl]amino] |
| Iso-Olomoucine |
| 2-{[6-(Benzylamino)-7-methyl-7H-purin-2-yl]amino}ethanol |
| Olomoucine,Iso |