5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine
Modify Date: 2026-06-21 12:18:21
5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine structure
|
Common Name | 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1016680-14-0 | Molecular Weight | 205.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11N3O2 |
|---|---|
| Molecular Weight | 205.21 |
| InChIKey | VGHXQUSGYQGXDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCC2=NN=C(O2)N |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine? |
| A: Molecular formula of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine is C10H11N3O2. |
| Q: What is the English name of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine? |
| A: The English name of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine is 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine. |
| Q: What is the molecular weight of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine? |
| A: Molecular weight of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine is 205.21. |
| Q: What is the CAS number of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine? |
| A: CAS number of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine is 1016680-14-0. |
| Q: What is the SMILES notation of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine? |
| A: SMILES notation of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine is C1=CC=C(C=C1)OCCC2=NN=C(O2)N. |
| Q: What is the InChIKey of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine? |
| A: InChIKey of 5-(2-Phenoxyethyl)-1,3,4-oxadiazol-2-amine is VGHXQUSGYQGXDG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1016680-14-0? |
| A: Chinese name of 1016680-14-0 is 1016680-14-0. |