Ethyl 6-(4-oxo-1-piperidinyl)nicotinate structure
|
Common Name | Ethyl 6-(4-oxo-1-piperidinyl)nicotinate | ||
|---|---|---|---|---|
| CAS Number | 1016885-83-8 | Molecular Weight | 248.278 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 427.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H16N2O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 212.5±28.7 °C | |
| Name | ethyl 6-(4-oxopiperidin-1-yl)pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.7±45.0 °C at 760 mmHg |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.278 |
| Flash Point | 212.5±28.7 °C |
| Exact Mass | 248.116089 |
| PSA | 59.50000 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | BIQRIKRNTXHPLU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N2CCC(=O)CC2)nc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 6-(4-oxopiperidin-1-yl)nicotinate |
| 3-Pyridinecarboxylic acid, 6-(4-oxo-1-piperidinyl)-, ethyl ester |
| Ethyl 6-(4-oxo-1-piperidinyl)nicotinate |