methyl 5,5-diphenylpenta-2,4-dienoate structure
|
Common Name | methyl 5,5-diphenylpenta-2,4-dienoate | ||
|---|---|---|---|---|
| CAS Number | 101723-21-1 | Molecular Weight | 264.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 5,5-diphenylpenta-2,4-dienoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H16O2 |
|---|---|
| Molecular Weight | 264.31800 |
| Exact Mass | 264.11500 |
| PSA | 26.30000 |
| LogP | 3.84750 |
| InChIKey | RXSQYCYZFXKHKU-UHFFFAOYSA-N |
| SMILES | COC(=O)C=CC=C(c1ccccc1)c1ccccc1 |
|
~%
methyl 5,5-diph... CAS#:101723-21-1 |
| Literature: Toa Eiyo Ltd.; National Cardiovascular Center, President of Patent: JP2005/247691 A, 2005 ; Location in patent: Page/Page column 20 ; |
|
~%
methyl 5,5-diph... CAS#:101723-21-1 |
| Literature: Klemm; Bower Journal of Organic Chemistry, 1958 , vol. 23, p. 344,347 |
| 5,5-diphenyl-(2E)-4-pentadienoic acid methyl ester |
| 5,5-diphenyl-penta-2t,4-dienoic acid methyl ester |
| 5,5-Diphenyl-penta-2t,4-diensaeure-methylester |
| 2,4-Pentadienoic acid,5,5-diphenyl-,methyl ester |