2,3,5,6-Tetrafluoro-4-(6-hydroxyhexyloxy)benzoic acid structure
|
Common Name | 2,3,5,6-Tetrafluoro-4-(6-hydroxyhexyloxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1017789-70-6 | Molecular Weight | 310.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14F4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,5,6-tetrafluoro-4-(6-hydroxyhexoxy)benzoic acid |
|---|
| Molecular Formula | C13H14F4O4 |
|---|---|
| Molecular Weight | 310.24100 |
| Exact Mass | 310.08300 |
| PSA | 66.76000 |
| LogP | 2.87270 |
| InChIKey | XDMXXHWZNZNGEA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(F)c(F)c(OCCCCCCO)c(F)c1F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |