Elliotinol structure
|
Common Name | Elliotinol | ||
|---|---|---|---|---|
| CAS Number | 10178-31-1 | Molecular Weight | 288.467 | |
| Density | 1.0±0.0 g/cm3 | Boiling Point | 380.4±0.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.6±0.0 °C | |
Use of Elliotinoltrans-Communol is a labdane diterpenoid, can be isolated from the aerial parts of Salvia cinnabarina[1]. |
| Name | 1,5-Diamino-2-methyl-9,10-anthraquinone |
|---|---|
| Synonym | More Synonyms |
| Description | trans-Communol is a labdane diterpenoid, can be isolated from the aerial parts of Salvia cinnabarina[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.0 g/cm3 |
|---|---|
| Boiling Point | 380.4±0.0 °C at 760 mmHg |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.467 |
| Flash Point | 126.6±0.0 °C |
| Exact Mass | 288.245331 |
| PSA | 20.23000 |
| LogP | 6.04 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | KDNYVXLYMQKQHH-OCHVYMGISA-N |
| SMILES | C=CC(C)=CCC1C(=C)CCC2C(C)(CO)CCCC12C |
| E-2-Propenoic acid,2-iodo-,methyl ester |
| trans Methyl 3-iodo-2-propenoate |
| trans-communol |
| 1-Naphthalenemethanol, decahydro-1,4a-dimethyl-6-methylene-5-[(2E)-3-methyl-2,4-pentadien-1-yl]-, (1S,4aR,5S,8aR)- |
| trans-3-iodoacrylic acid methyl ester |
| {(1S,4aR,5S,8aR)-1,4a-Dimethyl-6-methylene-5-[(2E)-3-methyl-2,4-pentadien-1-yl]decahydro-1-naphthalenyl}methanol |
| Elliotinol |