AKOS BC-0547 structure
|
Common Name | AKOS BC-0547 | ||
|---|---|---|---|---|
| CAS Number | 101821-81-2 | Molecular Weight | 222.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-Ethyl-1-adamantyl)acetic acid |
|---|
| Molecular Formula | C14H22O2 |
|---|---|
| Molecular Weight | 222.32300 |
| Exact Mass | 222.16200 |
| PSA | 37.30000 |
| LogP | 3.45770 |
| InChIKey | MRQRQHRHPXENRD-UHFFFAOYSA-N |
| SMILES | CCC12CC3CC(C1)CC(CC(=O)O)(C3)C2 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |