N-[(4-methoxyphenyl)methyl]nonanamide structure
|
Common Name | N-[(4-methoxyphenyl)methyl]nonanamide | ||
|---|---|---|---|---|
| CAS Number | 101832-19-3 | Molecular Weight | 277.40200 | |
| Density | 0.975g/cm3 | Boiling Point | 451.3ºC at 760mmHg | |
| Molecular Formula | C17H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | N-[(4-methoxyphenyl)methyl]nonanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.975g/cm3 |
|---|---|
| Boiling Point | 451.3ºC at 760mmHg |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.40200 |
| Flash Point | 226.8ºC |
| Exact Mass | 277.20400 |
| PSA | 41.82000 |
| LogP | 4.90230 |
| Vapour Pressure | 2.45E-08mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | LAOPYCHFTQZMDR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)NCc1ccc(OC)cc1 |
| HS Code | 2924299090 |
|---|
|
~69%
N-[(4-methoxyph... CAS#:101832-19-3 |
| Literature: Walpole; Wrigglesworth; Bevan; Campbell; Dray; James; Perkins; Reid; Winter Journal of Medicinal Chemistry, 1993 , vol. 36, # 16 p. 2362 - 2372 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Nonanamide,N-[(4-methoxyphenyl)methyl] |
| Pelargonsaeure-(4-methoxy-benzylamid) |
| nonanoic acid-(4-methoxy-benzylamide) |
| NONANAMIDE,N-(p-METHOXYBENZYL) |
| Nonansaeure-(4-methoxy-benzylamid) |
| N-(4-Methoxybenzyl)nonanamide |