N,N'-bis(2-chloroethyl)-N,N'-dimethylnonane-1,9-diamine structure
|
Common Name | N,N'-bis(2-chloroethyl)-N,N'-dimethylnonane-1,9-diamine | ||
|---|---|---|---|---|
| CAS Number | 101832-22-8 | Molecular Weight | 311.33400 | |
| Density | 0.993g/cm3 | Boiling Point | 327.5ºC at 760mmHg | |
| Molecular Formula | C15H32Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.9ºC | |
| Name | N,N'-bis(2-chloroethyl)-N,N'-dimethylnonane-1,9-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.993g/cm3 |
|---|---|
| Boiling Point | 327.5ºC at 760mmHg |
| Molecular Formula | C15H32Cl2N2 |
| Molecular Weight | 311.33400 |
| Flash Point | 151.9ºC |
| Exact Mass | 310.19400 |
| PSA | 6.48000 |
| LogP | 4.05830 |
| Vapour Pressure | 0.000201mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | NEVZRLPGIKOXTN-UHFFFAOYSA-N |
| SMILES | CN(CCCl)CCCCCCCCCN(C)CCCl |
|
~%
N,N'-bis(2-chlo... CAS#:101832-22-8 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 6, p. 164,168 |
|
~%
N,N'-bis(2-chlo... CAS#:101832-22-8 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 6, p. 164,168 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1,9-NONANEDIAMINE,N,N'-BIS(2-CHLOROETHYL)-N,N'-DIMETHYL |
| N,N'-bis-(2-chloro-ethyl)-N,N'-dimethyl-nonanediyldiamine |
| N,N'-Bis-(2-chlor-aethyl)-N,N'-dimethyl-nonandiyldiamin |
| N,N'-Bis(2-chloroethyl)-N,N'-dimethyl-1,9-nonanediamine |