2-methylbenzo[h][3,1]benzoxazin-4-one structure
|
Common Name | 2-methylbenzo[h][3,1]benzoxazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 101855-18-9 | Molecular Weight | 211.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylbenzo[h][3,1]benzoxazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9NO2 |
|---|---|
| Molecular Weight | 211.21600 |
| Exact Mass | 211.06300 |
| PSA | 43.10000 |
| LogP | 2.64960 |
| InChIKey | BLQMGWCQDAJNGK-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(ccc3ccccc32)c(=O)o1 |
|
~%
2-methylbenzo[h... CAS#:101855-18-9 |
| Literature: Reddy, Mandala Satyanarayana; Ratnam, Chengalvala Venkata Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 8 p. 2449 - 2450 |
|
~%
2-methylbenzo[h... CAS#:101855-18-9 |
| Literature: Reddy, Mandala Satyanarayana; Ratnam, Chengalvala Venkata Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 8 p. 2449 - 2450 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-methyl-4H-naphth[1,2-d][1,3]oxazin-4-one |
| 4H-Naphth[1,2-d][1,3]oxazin-4-one,2-methyl |