5-(5-nitrofuran-2-yl)-N-propyl-1H-1,2,4-triazol-3-amine structure
|
Common Name | 5-(5-nitrofuran-2-yl)-N-propyl-1H-1,2,4-triazol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 10187-90-3 | Molecular Weight | 237.21500 | |
| Density | 1.423g/cm3 | Boiling Point | 449.6ºC at 760 mmHg | |
| Molecular Formula | C9H11N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | 5-(5-nitrofuran-2-yl)-N-propyl-1H-1,2,4-triazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.423g/cm3 |
|---|---|
| Boiling Point | 449.6ºC at 760 mmHg |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.21500 |
| Flash Point | 225.7ºC |
| Exact Mass | 237.08600 |
| PSA | 115.79000 |
| LogP | 1.73990 |
| Vapour Pressure | 2.83E-08mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | ZLNLRWHLKXFYMC-UHFFFAOYSA-N |
| SMILES | CCCNc1n[nH]c(-c2ccc([N+](=O)[O-])o2)n1 |
| HS Code | 2934999090 |
|---|
|
~%
5-(5-nitrofuran... CAS#:10187-90-3 |
| Literature: Journal of medicinal chemistry, , vol. 16, # 4 p. 312 - 319 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Propylamino-3-(5-nitro-2-furyl)-s-triazole |
| [5-(5-nitro-furan-2-yl)-1H-[1,2,4]triazol-3-yl]-propyl-amine |
| s-Triazole,5-propylamino-3-(5-nitro-2-furyl) |
| 1H-1,2,4-Triazol-5-amine,3-(5-nitro-2-furyl)-N-propyl |
| Propylamine,N-(3-(5-nitro-2-furyl)-s-triazol-5-yl) |