2-propylquinoline-4-carboxylicacid structure
|
Common Name | 2-propylquinoline-4-carboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 1019-03-0 | Molecular Weight | 215.24800 | |
| Density | 1.205g/cm3 | Boiling Point | 361.4ºC at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Propylquinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 361.4ºC at 760 mmHg |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Exact Mass | 215.09500 |
| PSA | 50.19000 |
| LogP | 2.88550 |
| Vapour Pressure | 7.46E-06mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | GHWNIFKWPIVEPC-UHFFFAOYSA-N |
| SMILES | CCCc1cc(C(=O)O)c2ccccc2n1 |
| HS Code | 2933499090 |
|---|
|
~%
2-propylquinoli... CAS#:1019-03-0 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 16, p. 361 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Propyl-chinolin-4-carbonsaeure |
| HMS2445G18 |
| 2-Propyl-cinchoninsaeure |
| 2-propyl-quinoline-4-carboxylic acid |
| 2-propyl-4-quinolinecarboxylic acid |
| 2-n-Propyl-cinchoninsaeure |