3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid
Modify Date: 2025-11-06 11:09:02
![3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid Structure](https://www.chemsrc.com/extcaspic/232/1019357-65-3.png)
3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid structure
|
Common Name | 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1019357-65-3 | Molecular Weight | 247.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13NO4 |
|---|---|
| Molecular Weight | 247.25 |
| InChIKey | XNECMDGPKZMMNM-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cnc(CCC(=O)O)o2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid? |
| A: CAS number of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid is 1019357-65-3. |
| Q: What is the SMILES notation of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid? |
| A: SMILES notation of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid is COc1ccc(-c2cnc(CCC(=O)O)o2)cc1. |
| Q: What is the InChIKey of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid? |
| A: InChIKey of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid is XNECMDGPKZMMNM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid? |
| A: Molecular formula of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid is C13H13NO4. |
| Q: What is the molecular weight of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid? |
| A: Molecular weight of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid is 247.25. |
| Q: What is the English name of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid? |
| A: The English name of 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid is 3-[5-(4-Methoxyphenyl)-1,3-oxazol-2-yl]propanoic acid. |
| Q: What is the Chinese name of 1019357-65-3? |
| A: Chinese name of 1019357-65-3 is 1019357-65-3. |