(E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate
Modify Date: 2026-08-07 11:23:27
(E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate structure
|
Common Name | (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 101979-11-7 | Molecular Weight | 222.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14O5S |
|---|---|
| Molecular Weight | 222.26 |
| InChIKey | IPYKRTDWSKXDHI-GQCTYLIASA-N |
| SMILES | CCOC(=O)C=CCCOS(C)(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate? |
| A: Molecular formula of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate is C8H14O5S. |
| Q: What is the English name of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate? |
| A: The English name of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate is (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate. |
| Q: What is the Chinese name of 101979-11-7? |
| A: Chinese name of 101979-11-7 is 101979-11-7. |
| Q: What is the SMILES notation of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate? |
| A: SMILES notation of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate is CCOC(=O)C=CCCOS(C)(=O)=O. |
| Q: What is the InChIKey of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate? |
| A: InChIKey of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate is IPYKRTDWSKXDHI-GQCTYLIASA-N. |
| Q: What is the molecular weight of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate? |
| A: Molecular weight of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate is 222.26. |
| Q: What is the CAS number of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate? |
| A: CAS number of (E)-4-(ethoxycarbonyl)but-3-enyl methanesulfonate is 101979-11-7. |