1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl
Modify Date: 2026-07-04 19:20:49
![1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl Structure](https://www.chemsrc.com/extcaspic/307/101983-70-4.png)
1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl structure
|
Common Name | 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 101983-70-4 | Molecular Weight | 373.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23N7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H23N7 |
|---|---|
| Molecular Weight | 373.5 |
| InChIKey | RPPFIOMUTFFYDE-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)Nc1ccc(N=Nc2ccc3n[nH]nc3c2)c2ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl? |
| A: CAS number of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl is 101983-70-4. |
| Q: What is the InChIKey of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl? |
| A: InChIKey of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl is RPPFIOMUTFFYDE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl? |
| A: Molecular weight of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl is 373.5. |
| Q: What is the Chinese name of 101983-70-4? |
| A: Chinese name of 101983-70-4 is 101983-70-4. |
| Q: What is the molecular formula of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl? |
| A: Molecular formula of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl is C21H23N7. |
| Q: What is the English name of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl? |
| A: The English name of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl is 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl. |
| Q: What is the SMILES notation of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl? |
| A: SMILES notation of 1,2-Propanediamine, N2-[4-[2-(1H-benzotriazol-6-yl)diazenyl]-1-naphthalenyl]-N1,N1-dimethyl is CC(CN(C)C)Nc1ccc(N=Nc2ccc3n[nH]nc3c2)c2ccccc12. |