Sulfaclozine structure
|
Common Name | Sulfaclozine | ||
|---|---|---|---|---|
| CAS Number | 102-65-8 | Molecular Weight | 284.722 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 495.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C10H9ClN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.6±31.5 °C | |
Use of SulfaclozineSulfaclozine is an efficacious sulphonamide derivative with antibacterial and anticoccidial effects.Target: Antibacterial, AntiparasiticSulfaclozine is an antibiotic commonly used in poultry for the treatment of coccidiosis and various infectious diseases, in broiler chickens. Sulfaclozine is commonly used for the treatment of various poultry diseases (particularly, collibacteriosis, fowl cholera and coccidiosis). |
| Name | 4-amino-N-(6-chloropyrazin-2-yl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfaclozine is an efficacious sulphonamide derivative with antibacterial and anticoccidial effects.Target: Antibacterial, AntiparasiticSulfaclozine is an antibiotic commonly used in poultry for the treatment of coccidiosis and various infectious diseases, in broiler chickens. Sulfaclozine is commonly used for the treatment of various poultry diseases (particularly, collibacteriosis, fowl cholera and coccidiosis). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.7±55.0 °C at 760 mmHg |
| Molecular Formula | C10H9ClN4O2S |
| Molecular Weight | 284.722 |
| Flash Point | 253.6±31.5 °C |
| Exact Mass | 284.013458 |
| PSA | 106.35000 |
| LogP | 1.33 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | QKLPUVXBJHRFQZ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)Nc2cncc(Cl)n2)cc1 |
| HS Code | 2935009090 |
|---|
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 6-Chlor-2-sulfanilamino-pyrazin |
| sulfachloropyrazine |
| EINECS 203-044-0 |
| Sulfachlorpyrazin |
| Sulfaclozinum |
| 4-amino-N-(6-chloropyrazin-2-yl)benzenesulfonamide |
| Benzenesulfonamide, 4-amino-N-(6-chloro-2-pyrazinyl)- |
| N-(6-chloropyrazinyl)sulfanilamide |
| Sulfaclozina |
| 4-Amino-N-(6-chloro-2-pyrazinyl)benzenesulfonamide |
| Sulfaclozine |