4-(benzothiazol-2-ylthio)-2,6-dimethylmorpholine structure
|
Common Name | 4-(benzothiazol-2-ylthio)-2,6-dimethylmorpholine | ||
|---|---|---|---|---|
| CAS Number | 102-78-3 | Molecular Weight | 280.40900 | |
| Density | 1.3g/cm3 | Boiling Point | 417.1ºC at 760mmHg | |
| Molecular Formula | C13H16N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-2,6-dimethylmorpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 417.1ºC at 760mmHg |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.40900 |
| Flash Point | 206.1ºC |
| Exact Mass | 280.07000 |
| PSA | 78.90000 |
| LogP | 3.35050 |
| Vapour Pressure | 3.62E-07mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | DNPSGCQXSGVQSK-UHFFFAOYSA-N |
| SMILES | CC1CN(Sc2nc3ccccc3s2)CC(C)O1 |
| HS Code | 2934999090 |
|---|
|
~%
4-(benzothiazol... CAS#:102-78-3 |
| Literature: D'Amico et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 5270,5271 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(benzo[d]thiazol-2-ylthio)-2,6-dimethylmorpholine |
| 4-(Benzothiazol-2-sulfenyl)-2,6-dimethyl-morpholin |
| 2-(2,6-Dimethylmorpholinosulfenyl)-benzothiazol |
| 2-(2',6'-Dimethyl-4-morpholinothio)benzothiazole |
| 2-(2,6-dimethyl-morpholin-4-ylsulfanyl)-benzothiazole |
| EINECS 203-054-5 |
| 4-(Benzothiazol-2-ylthio)-2,6-dimethylmorpholine |
| 4-(benzothiazole-2-sulfenyl)-2,6-dimethyl-morpholine |
| Morpholine,4-(2-benzothiazolylthio)-2,6-dimethyl |
| 2-(2,6-Dimethylmorpholinothio)benzothiazol |