4,5-dibromo-2-nitro-benzoic acid
4,5-dibromo-2-nitro-benzoic acid structure
|
Common Name | 4,5-dibromo-2-nitro-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 102000-63-5 | Molecular Weight | 324.91100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Br2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-dibromo-2-nitro-benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3Br2NO4 |
|---|---|
| Molecular Weight | 324.91100 |
| Exact Mass | 322.84300 |
| PSA | 83.12000 |
| LogP | 3.34120 |
| InChIKey | RZPONWOLLSMIKL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Br)c(Br)cc1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916399090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:75057-62-4
CAS#:118-92-3This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,5-Dibrom-2-nitro-benzoesaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4,5-dibromo-2-nitro-benzoic acid? |
| A: LogP of 4,5-dibromo-2-nitro-benzoic acid is 3.34120. |
| Q: What are the downstream products of 4,5-dibromo-2-nitro-benzoic acid? |
| A: Related downstream products(CAS) of 4,5-dibromo-2-nitro-benzoic acid: 75057-62-4;118-92-3. |
| Q: What is the polar surface area (PSA) of 4,5-dibromo-2-nitro-benzoic acid? |
| A: Polar surface area (PSA) of 4,5-dibromo-2-nitro-benzoic acid is 83.12000. |
| Q: What is the molecular weight of 4,5-dibromo-2-nitro-benzoic acid? |
| A: Molecular weight of 4,5-dibromo-2-nitro-benzoic acid is 324.91100. |
| Q: What is the CAS number of 4,5-dibromo-2-nitro-benzoic acid? |
| A: CAS number of 4,5-dibromo-2-nitro-benzoic acid is 102000-63-5. |
| Q: What is the SMILES notation of 4,5-dibromo-2-nitro-benzoic acid? |
| A: SMILES notation of 4,5-dibromo-2-nitro-benzoic acid is O=C(O)c1cc(Br)c(Br)cc1[N+](=O)[O-]. |
| Q: What is the Chinese name of 102000-63-5? |
| A: Chinese name of 102000-63-5 is 102000-63-5. |
| Q: What is the English name of 4,5-dibromo-2-nitro-benzoic acid? |
| A: The English name of 4,5-dibromo-2-nitro-benzoic acid is 4,5-dibromo-2-nitro-benzoic acid. |
| Q: What English synonyms does 4,5-dibromo-2-nitro-benzoic acid have? |
| A: English synonyms of 4,5-dibromo-2-nitro-benzoic acid: 4,5-Dibrom-2-nitro-benzoesaeure. |
| Q: What is the InChIKey of 4,5-dibromo-2-nitro-benzoic acid? |
| A: InChIKey of 4,5-dibromo-2-nitro-benzoic acid is RZPONWOLLSMIKL-UHFFFAOYSA-N. |