2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline structure
|
Common Name | 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline | ||
|---|---|---|---|---|
| CAS Number | 102012-70-4 | Molecular Weight | 339.38500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(6,7-dimethoxynaphthalen-2-yl)-4,5-dimethoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H21NO4 |
|---|---|
| Molecular Weight | 339.38500 |
| Exact Mass | 339.14700 |
| PSA | 62.94000 |
| LogP | 4.70460 |
| InChIKey | MVXFWIJIPARTPT-UHFFFAOYSA-N |
| SMILES | COc1cc(N)c(-c2ccc3cc(OC)c(OC)cc3c2)cc1OC |
|
~99%
2-(6,7-dimethox... CAS#:102012-70-4 |
| Literature: US2003/100560 A1, ; |
|
~97%
2-(6,7-dimethox... CAS#:102012-70-4 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 7 p. 1475 - 1491 |
|
~%
2-(6,7-dimethox... CAS#:102012-70-4 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 7 p. 1475 - 1491 |
|
~%
2-(6,7-dimethox... CAS#:102012-70-4 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 7 p. 1475 - 1491 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(6,7-dimethoxy-[2]naphthyl)-4,5-dimethoxy-aniline |
| 6-(2-amino-4,5-dimethoxyphenyl)-2,3-dimethoxynaphthalene |
| 2-(6,7-Dimethoxy-[2]naphthyl)-4,5-dimethoxy-anilin |
| Benzenamine,2-(6,7-dimethoxy-2-naphthalenyl)-4,5-dimethoxy |