2-[4-[3-(6-chlorothieno[2,3-b][1,4]benzothiazin-4-yl)propyl]piperazin-1-yl]ethanol structure
|
Common Name | 2-[4-[3-(6-chlorothieno[2,3-b][1,4]benzothiazin-4-yl)propyl]piperazin-1-yl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 10202-24-1 | Molecular Weight | 409.99600 | |
| Density | 1.314g/cm3 | Boiling Point | 587.7ºC at 760 mmHg | |
| Molecular Formula | C19H24ClN3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.2ºC | |
| Name | 2-[4-[3-(6-chlorothieno[2,3-b][1,4]benzothiazin-4-yl)propyl]piperazin-1-yl]ethanol |
|---|
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 587.7ºC at 760 mmHg |
| Molecular Formula | C19H24ClN3OS2 |
| Molecular Weight | 409.99600 |
| Flash Point | 309.2ºC |
| Exact Mass | 409.10500 |
| PSA | 83.49000 |
| LogP | 3.94500 |
| Vapour Pressure | 1.18E-14mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | AIQZJGRZPNRVCO-UHFFFAOYSA-N |
| SMILES | OCCN1CCN(CCCN2c3cc(Cl)ccc3Sc3sccc32)CC1 |
|
~%
2-[4-[3-(6-chlo... CAS#:10202-24-1 |
| Literature: Grol, Cor J.; Rollema, Hans; Dijkstra, Durk; Westernik, Ben H. C. Journal of Medicinal Chemistry, 1980 , vol. 23, # 3 p. 322 - 324 |
|
~%
2-[4-[3-(6-chlo... CAS#:10202-24-1 |
| Literature: Grol, Cor J.; Rollema, Hans; Dijkstra, Durk; Westernik, Ben H. C. Journal of Medicinal Chemistry, 1980 , vol. 23, # 3 p. 322 - 324 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |