sulfathiazole-d4
sulfathiazole-d4 structure
|
Common Name | sulfathiazole-d4 | ||
|---|---|---|---|---|
| CAS Number | 1020719-89-4 | Molecular Weight | 259.341 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 479.5±47.0 °C at 760 mmHg | |
| Molecular Formula | C9H5D4N3O2S2 | Melting Point | 172-174°C | |
| MSDS | N/A | Flash Point | 243.8±29.3 °C | |
Use of sulfathiazole-d4Sulfathiazole D4 is a deuterium labeled Sulfathiazole. Sulfathiazole, an organosulfur compound, is used as a short-acting sulfonamide antibiotic[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Sulfathiazole D4 is a deuterium labeled Sulfathiazole. Sulfathiazole, an organosulfur compound, is used as a short-acting sulfonamide antibiotic[1]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 479.5±47.0 °C at 760 mmHg |
| Melting Point | 172-174°C |
| Molecular Formula | C9H5D4N3O2S2 |
| Molecular Weight | 259.341 |
| Flash Point | 243.8±29.3 °C |
| Exact Mass | 259.038727 |
| LogP | 0.05 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.704 |
| InChIKey | JNMRHUJNCSQMMB-RHQRLBAQSA-N |
| SMILES | Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| Storage condition | -20°C Freezer |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Amino-N-(1,3-thiazol-2-yl)(H)benzenesulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide? |
| A: Boiling point of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide is 479.5±47.0 °C at 760 mmHg. |
| Q: What is the InChIKey of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide? |
| A: InChIKey of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide is JNMRHUJNCSQMMB-RHQRLBAQSA-N. |
| Q: What is the CAS number of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide? |
| A: CAS number of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide is 1020719-89-4. |
| Q: What is the LogP of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide? |
| A: LogP of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide is 0.05. |
| Q: What are the storage conditions for 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide? |
| A: Storage conditions for 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide: -20°C Freezer. |
| Q: What is the English name of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide? |
| A: The English name of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide is 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide. |
| Q: What is the SMILES notation of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide? |
| A: SMILES notation of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide is Nc1ccc(S(=O)(=O)Nc2nccs2)cc1. |
| Q: What is the molecular formula of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide? |
| A: Molecular formula of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide is C9H5D4N3O2S2. |
| Q: What is the melting point of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide? |
| A: Melting point of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide is 172-174°C. |
| Q: What English synonyms does 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide have? |
| A: English synonyms of 4-Amino-N-(1,3-thiazol-2-yl)(2H4)benzenesulfonamide: 4-Amino-N-(1,3-thiazol-2-yl)(H)benzenesulfonamide. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |